1,3,5-Tris(4'-carboxy[1,1'-biphenyl]-4-yl)benzene
Request a quote| Catalog Number | ACM911818752-2 |
| CAS | 911818-75-2 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/911818-75-2.gif) |
| Description | 1,3,5-Tris(4'-carboxy[1,1'-biphenyl]-4-yl)benzene is used as a linker molecule for the synthesis of high performance metal-organic framework (MOFs). |
| IUPAC Name | 4-[4-[3,5-bis[4-(4-carboxyphenyl)phenyl]phenyl]phenyl]benzoic acid |
| Synonyms | TCBPB |
| Molecular Weight | 666.72 |
| Molecular Formula | C45H30O6 |
| Canonical SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C(=O)O)C3=CC(=CC(=C3)C4=CC=C(C=C4)C5=CC=C(C=C5)C(=O)O)C6=CC=C(C=C6)C7=CC=C(C=C7)C(=O)O |
| Inchi | 1S/C45H30O6/c46-43(47)37-19-13-31(14-20-37)28-1-7-34(8-2-28)40-25-41(35-9-3-29(4-10-35)32-15-21-38(22-16-32)44(48)49)27-42(26-40)36-11-5-30(6-12-36)33-17-23-39(24-18-33)45(50)51/h1-27H,(H,46,47)(H,48,49)(H,50,51) |
| InChIKey | PEQRGMPXYDIZSX-UHFFFAOYSA-N |
| Melting Point | >300 °C |
| Flash Point | Not applicable |
| Purity | 97% |
| Appearance | Yellow solid |
| Storage | 2-8°C |
| Physical State | Light yellow solid |
Ask Your Question
